About heptadecane-1,7-diol
heptadecane-1,7-diol (PubChem CID 130297854) has the molecular formula C17H36O2
and a molecular weight of 272.47 g/mol. Its IUPAC name is heptadecane-1,7-diol.
Molecular Properties
| Compound Name | heptadecane-1,7-diol |
| PubChem CID | 130297854 |
| Molecular Formula | C17H36O2 |
| Molecular Weight | 272.47 g/mol |
| Exact Mass | 272.27 |
| IUPAC Name | heptadecane-1,7-diol |
| SMILES | CCCCCCCCCCC(O)CCCCCCO |
| InChI | InChI=1S/C17H36O2/c1-2-3-4-5-6-7-8-11-14-17(19)15-12-9-10-13-16-18/h17-19H,2-16H2,1H3 |
| InChIKey | WTKXTKKCNBEVFB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptadecane-1,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadecane-1,7-diol?
The IUPAC name of heptadecane-1,7-diol (CID 130297854) is heptadecane-1,7-diol.
What is the SMILES notation for heptadecane-1,7-diol?
The canonical SMILES for heptadecane-1,7-diol is CCCCCCCCCCC(O)CCCCCCO.
What is the InChIKey of heptadecane-1,7-diol?
The InChIKey is WTKXTKKCNBEVFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O2/c1-2-3-4-5-6-7-8-11-14-17(19)15-12-9-10-13-16-18/h17-19H,2-16H2,1H3.
What are the key properties of heptadecane-1,7-diol?
heptadecane-1,7-diol has a molecular weight of 272.47 g/mol, XLogP of 4.82, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptadecane-1,7-diol is sourced from PubChem (CID 130297854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).