About docosane-1,11-diol
docosane-1,11-diol (PubChem CID 54487610) has the molecular formula C22H46O2
and a molecular weight of 342.61 g/mol. Its IUPAC name is docosane-1,11-diol.
Molecular Properties
| Compound Name | docosane-1,11-diol |
| PubChem CID | 54487610 |
| Molecular Formula | C22H46O2 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.35 |
| IUPAC Name | docosane-1,11-diol |
| SMILES | CCCCCCCCCCCC(O)CCCCCCCCCCO |
| InChI | InChI=1S/C22H46O2/c1-2-3-4-5-6-7-10-13-16-19-22(24)20-17-14-11-8-9-12-15-18-21-23/h22-24H,2-21H2,1H3 |
| InChIKey | XTKRCDUBPHSAEO-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze docosane-1,11-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of docosane-1,11-diol?
The IUPAC name of docosane-1,11-diol (CID 54487610) is docosane-1,11-diol.
What is the SMILES notation for docosane-1,11-diol?
The canonical SMILES for docosane-1,11-diol is CCCCCCCCCCCC(O)CCCCCCCCCCO.
What is the InChIKey of docosane-1,11-diol?
The InChIKey is XTKRCDUBPHSAEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46O2/c1-2-3-4-5-6-7-10-13-16-19-22(24)20-17-14-11-8-9-12-15-18-21-23/h22-24H,2-21H2,1H3.
What are the key properties of docosane-1,11-diol?
docosane-1,11-diol has a molecular weight of 342.61 g/mol, XLogP of 6.77, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for docosane-1,11-diol is sourced from PubChem (CID 54487610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).