About (9R)-octadecane-1,9-diol
(9R)-octadecane-1,9-diol (PubChem CID 10968142) has the molecular formula C18H38O2
and a molecular weight of 286.50 g/mol. Its IUPAC name is (9R)-octadecane-1,9-diol.
Molecular Properties
| Compound Name | (9R)-octadecane-1,9-diol |
| PubChem CID | 10968142 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | (9R)-octadecane-1,9-diol |
| SMILES | CCCCCCCCC[C@@H](O)CCCCCCCCO |
| InChI | InChI=1S/C18H38O2/c1-2-3-4-5-6-9-12-15-18(20)16-13-10-7-8-11-14-17-19/h18-20H,2-17H2,1H3/t18-/m1/s1 |
| InChIKey | GUQPPNZGDSQJGT-GOSISDBHSA-N |
| XLogP | 5.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (9R)-octadecane-1,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9R)-octadecane-1,9-diol?
The IUPAC name of (9R)-octadecane-1,9-diol (CID 10968142) is (9R)-octadecane-1,9-diol.
What is the SMILES notation for (9R)-octadecane-1,9-diol?
The canonical SMILES for (9R)-octadecane-1,9-diol is CCCCCCCCC[C@@H](O)CCCCCCCCO.
What is the InChIKey of (9R)-octadecane-1,9-diol?
The InChIKey is GUQPPNZGDSQJGT-GOSISDBHSA-N. The full InChI is InChI=1S/C18H38O2/c1-2-3-4-5-6-9-12-15-18(20)16-13-10-7-8-11-14-17-19/h18-20H,2-17H2,1H3/t18-/m1/s1.
What are the key properties of (9R)-octadecane-1,9-diol?
(9R)-octadecane-1,9-diol has a molecular weight of 286.50 g/mol, XLogP of 5.21, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (9R)-octadecane-1,9-diol is sourced from PubChem (CID 10968142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).