C12H28O5 — CID 22728671
hexane-1,2-diol;hexane-1,2,6-triol (PubChem CID 22728671) has the molecular formula C12H28O5 and a molecular weight of 252.35 g/mol. Its IUPAC name is hexane-1,2-diol;hexane-1,2,6-triol.
| Compound Name | hexane-1,2-diol;hexane-1,2,6-triol |
|---|---|
| PubChem CID | 22728671 |
| Molecular Formula | C12H28O5 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | hexane-1,2-diol;hexane-1,2,6-triol |
| SMILES | CCCCC(O)CO.OCCCCC(O)CO |
| InChI | InChI=1S/C6H14O3.C6H14O2/c7-4-2-1-3-6(9)5-8;1-2-3-4-6(8)5-7/h6-9H,1-5H2;6-8H,2-5H2,1H3 |
| InChIKey | VNJJOSOIDOYBKO-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|