C12H28O4 — CID 158152715
hexane-1,1-diol;hexane-1,2-diol (PubChem CID 158152715) has the molecular formula C12H28O4 and a molecular weight of 236.35 g/mol. Its IUPAC name is hexane-1,1-diol;hexane-1,2-diol.
| Compound Name | hexane-1,1-diol;hexane-1,2-diol |
|---|---|
| PubChem CID | 158152715 |
| Molecular Formula | C12H28O4 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | hexane-1,1-diol;hexane-1,2-diol |
| SMILES | CCCCC(O)CO.CCCCCC(O)O |
| InChI | InChI=1S/2C6H14O2/c1-2-3-4-6(8)5-7;1-2-3-4-5-6(7)8/h2*6-8H,2-5H2,1H3 |
| InChIKey | FVHVHJZQCPCEQG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|