C27H58O4 — CID 87487679
tetradecane-1,1-diol;tridecane-1,1-diol (PubChem CID 87487679) has the molecular formula C27H58O4 and a molecular weight of 446.76 g/mol. Its IUPAC name is tetradecane-1,1-diol;tridecane-1,1-diol.
| Compound Name | tetradecane-1,1-diol;tridecane-1,1-diol |
|---|---|
| PubChem CID | 87487679 |
| Molecular Formula | C27H58O4 |
| Molecular Weight | 446.76 g/mol |
| Exact Mass | 446.43 |
| IUPAC Name | tetradecane-1,1-diol;tridecane-1,1-diol |
| SMILES | CCCCCCCCCCCCC(O)O.CCCCCCCCCCCCCC(O)O |
| InChI | InChI=1S/C14H30O2.C13H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h14-16H,2-13H2,1H3;13-15H,2-12H2,1H3 |
| InChIKey | FVEOEBTZTRHSEZ-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.76 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|