C7H14O5-2 — CID 22286932
hexane-1,1-diol carbonate (PubChem CID 22286932) has the molecular formula C7H14O5-2 and a molecular weight of 178.18 g/mol. Its IUPAC name is hexane-1,1-diol carbonate.
| Compound Name | hexane-1,1-diol carbonate |
|---|---|
| PubChem CID | 22286932 |
| Molecular Formula | C7H14O5-2 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | hexane-1,1-diol carbonate |
| SMILES | CCCCCC(O)O.O=C([O-])[O-] |
| InChI | InChI=1S/C6H14O2.CH2O3/c1-2-3-4-5-6(7)8;2-1(3)4/h6-8H,2-5H2,1H3;(H2,2,3,4)/p-2 |
| InChIKey | PMZMWAYZWXPNAI-UHFFFAOYSA-L |
| XLogP | -1.57 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|