C13H30O4 — CID 161393558
heptane-1,1-diol;hexane-1,1-diol (PubChem CID 161393558) has the molecular formula C13H30O4 and a molecular weight of 250.38 g/mol. Its IUPAC name is heptane-1,1-diol;hexane-1,1-diol.
| Compound Name | heptane-1,1-diol;hexane-1,1-diol |
|---|---|
| PubChem CID | 161393558 |
| Molecular Formula | C13H30O4 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | heptane-1,1-diol;hexane-1,1-diol |
| SMILES | CCCCCC(O)O.CCCCCCC(O)O |
| InChI | InChI=1S/C7H16O2.C6H14O2/c1-2-3-4-5-6-7(8)9;1-2-3-4-5-6(7)8/h7-9H,2-6H2,1H3;6-8H,2-5H2,1H3 |
| InChIKey | VTHNHELDCMHJBK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|