C8H18O4 — CID 88519685
octane-1,1,8,8-tetrol (PubChem CID 88519685) has the molecular formula C8H18O4 and a molecular weight of 178.23 g/mol. Its IUPAC name is octane-1,1,8,8-tetrol.
| Compound Name | octane-1,1,8,8-tetrol |
|---|---|
| PubChem CID | 88519685 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | octane-1,1,8,8-tetrol |
| SMILES | OC(O)CCCCCCC(O)O |
| InChI | InChI=1S/C8H18O4/c9-7(10)5-3-1-2-4-6-8(11)12/h7-12H,1-6H2 |
| InChIKey | NUPSKCRTAGBJJH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|