About 21,21-dihydroxyhenicosylazanium chloride
21,21-dihydroxyhenicosylazanium chloride (PubChem CID 139822452) has the molecular formula C21H46ClNO2
and a molecular weight of 380.06 g/mol. Its IUPAC name is 21,21-dihydroxyhenicosylazanium chloride.
Molecular Properties
| Compound Name | 21,21-dihydroxyhenicosylazanium chloride |
| PubChem CID | 139822452 |
| Molecular Formula | C21H46ClNO2 |
| Molecular Weight | 380.06 g/mol |
| Exact Mass | 379.32 |
| IUPAC Name | 21,21-dihydroxyhenicosylazanium chloride |
| SMILES | [Cl-].[NH3+]CCCCCCCCCCCCCCCCCCCCC(O)O |
| InChI | InChI=1S/C21H45NO2.ClH/c22-20-18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19-21(23)24;/h21,23-24H,1-20,22H2;1H |
| InChIKey | USGZMMVPKQHPMP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.06 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 21,21-dihydroxyhenicosylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 21,21-dihydroxyhenicosylazanium chloride?
The IUPAC name of 21,21-dihydroxyhenicosylazanium chloride (CID 139822452) is 21,21-dihydroxyhenicosylazanium chloride.
What is the SMILES notation for 21,21-dihydroxyhenicosylazanium chloride?
The canonical SMILES for 21,21-dihydroxyhenicosylazanium chloride is [Cl-].[NH3+]CCCCCCCCCCCCCCCCCCCCC(O)O.
What is the InChIKey of 21,21-dihydroxyhenicosylazanium chloride?
The InChIKey is USGZMMVPKQHPMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H45NO2.ClH/c22-20-18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19-21(23)24;/h21,23-24H,1-20,22H2;1H.
What are the key properties of 21,21-dihydroxyhenicosylazanium chloride?
21,21-dihydroxyhenicosylazanium chloride has a molecular weight of 380.06 g/mol, XLogP of 1.95, 20 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 21,21-dihydroxyhenicosylazanium chloride is sourced from PubChem (CID 139822452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).