C17H37NO4 — CID 123788893
17-(hydroxyamino)heptadecane-1,1,17-triol (PubChem CID 123788893) has the molecular formula C17H37NO4 and a molecular weight of 319.49 g/mol. Its IUPAC name is 17-(hydroxyamino)heptadecane-1,1,17-triol.
| Compound Name | 17-(hydroxyamino)heptadecane-1,1,17-triol |
|---|---|
| PubChem CID | 123788893 |
| Molecular Formula | C17H37NO4 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.27 |
| IUPAC Name | 17-(hydroxyamino)heptadecane-1,1,17-triol |
| SMILES | ONC(O)CCCCCCCCCCCCCCCC(O)O |
| InChI | InChI=1S/C17H37NO4/c19-16(18-22)14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17(20)21/h16-22H,1-15H2 |
| InChIKey | QLEPGCGUPQOJBM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|