About 10-(methylamino)decane-1,1-diol
10-(methylamino)decane-1,1-diol (PubChem CID 151651816) has the molecular formula C11H25NO2
and a molecular weight of 203.33 g/mol. Its IUPAC name is 10-(methylamino)decane-1,1-diol.
Molecular Properties
| Compound Name | 10-(methylamino)decane-1,1-diol |
| PubChem CID | 151651816 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | 10-(methylamino)decane-1,1-diol |
| SMILES | CNCCCCCCCCCC(O)O |
| InChI | InChI=1S/C11H25NO2/c1-12-10-8-6-4-2-3-5-7-9-11(13)14/h11-14H,2-10H2,1H3 |
| InChIKey | QURAOOFJWPBMHK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 10-(methylamino)decane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(methylamino)decane-1,1-diol?
The IUPAC name of 10-(methylamino)decane-1,1-diol (CID 151651816) is 10-(methylamino)decane-1,1-diol.
What is the SMILES notation for 10-(methylamino)decane-1,1-diol?
The canonical SMILES for 10-(methylamino)decane-1,1-diol is CNCCCCCCCCCC(O)O.
What is the InChIKey of 10-(methylamino)decane-1,1-diol?
The InChIKey is QURAOOFJWPBMHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO2/c1-12-10-8-6-4-2-3-5-7-9-11(13)14/h11-14H,2-10H2,1H3.
What are the key properties of 10-(methylamino)decane-1,1-diol?
10-(methylamino)decane-1,1-diol has a molecular weight of 203.33 g/mol, XLogP of 1.64, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(methylamino)decane-1,1-diol is sourced from PubChem (CID 151651816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).