C11H27N — CID 169159475
N,6-dimethylheptan-1-amine;ethane (PubChem CID 169159475) has the molecular formula C11H27N and a molecular weight of 173.34 g/mol. Its IUPAC name is N,6-dimethylheptan-1-amine;ethane.
| Compound Name | N,6-dimethylheptan-1-amine;ethane |
|---|---|
| PubChem CID | 169159475 |
| Molecular Formula | C11H27N |
| Molecular Weight | 173.34 g/mol |
| Exact Mass | 173.21 |
| IUPAC Name | N,6-dimethylheptan-1-amine;ethane |
| SMILES | CC.CNCCCCCC(C)C |
| InChI | InChI=1S/C9H21N.C2H6/c1-9(2)7-5-4-6-8-10-3;1-2/h9-10H,4-8H2,1-3H3;1-2H3 |
| InChIKey | MNMMDDNCAMVFHV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|