C10H25N — CID 142540507
N,5-dimethylhexan-1-amine;ethane (PubChem CID 142540507) has the molecular formula C10H25N and a molecular weight of 159.32 g/mol. Its IUPAC name is N,5-dimethylhexan-1-amine;ethane.
| Compound Name | N,5-dimethylhexan-1-amine;ethane |
|---|---|
| PubChem CID | 142540507 |
| Molecular Formula | C10H25N |
| Molecular Weight | 159.32 g/mol |
| Exact Mass | 159.20 |
| IUPAC Name | N,5-dimethylhexan-1-amine;ethane |
| SMILES | CC.CNCCCCC(C)C |
| InChI | InChI=1S/C8H19N.C2H6/c1-8(2)6-4-5-7-9-3;1-2/h8-9H,4-7H2,1-3H3;1-2H3 |
| InChIKey | MOSWKNREXHGOFR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|