About N,5-dimethyloctan-1-amine;ethane;molecular hydrogen
N,5-dimethyloctan-1-amine;ethane;molecular hydrogen (PubChem CID 142588186) has the molecular formula C14H37N
and a molecular weight of 219.46 g/mol. Its IUPAC name is N,5-dimethyloctan-1-amine;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | N,5-dimethyloctan-1-amine;ethane;molecular hydrogen |
| PubChem CID | 142588186 |
| Molecular Formula | C14H37N |
| Molecular Weight | 219.46 g/mol |
| Exact Mass | 219.29 |
| IUPAC Name | N,5-dimethyloctan-1-amine;ethane;molecular hydrogen |
| SMILES | CC.CC.CCCC(C)CCCCNC.[H][H] |
| InChI | InChI=1S/C10H23N.2C2H6.H2/c1-4-7-10(2)8-5-6-9-11-3;2*1-2;/h10-11H,4-9H2,1-3H3;2*1-2H3;1H |
| InChIKey | NOHRXIPQXCUWNE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 219.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,5-dimethyloctan-1-amine;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-dimethyloctan-1-amine;ethane;molecular hydrogen?
The IUPAC name of N,5-dimethyloctan-1-amine;ethane;molecular hydrogen (CID 142588186) is N,5-dimethyloctan-1-amine;ethane;molecular hydrogen.
What is the SMILES notation for N,5-dimethyloctan-1-amine;ethane;molecular hydrogen?
The canonical SMILES for N,5-dimethyloctan-1-amine;ethane;molecular hydrogen is CC.CC.CCCC(C)CCCCNC.[H][H].
What is the InChIKey of N,5-dimethyloctan-1-amine;ethane;molecular hydrogen?
The InChIKey is NOHRXIPQXCUWNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N.2C2H6.H2/c1-4-7-10(2)8-5-6-9-11-3;2*1-2;/h10-11H,4-9H2,1-3H3;2*1-2H3;1H.
What are the key properties of N,5-dimethyloctan-1-amine;ethane;molecular hydrogen?
N,5-dimethyloctan-1-amine;ethane;molecular hydrogen has a molecular weight of 219.46 g/mol, XLogP of 5.11, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-dimethyloctan-1-amine;ethane;molecular hydrogen is sourced from PubChem (CID 142588186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).