C19H40 — CID 123827297
2,9,13-trimethylhexadecane (PubChem CID 123827297) has the molecular formula C19H40 and a molecular weight of 268.53 g/mol. Its IUPAC name is 2,9,13-trimethylhexadecane.
| Compound Name | 2,9,13-trimethylhexadecane |
|---|---|
| PubChem CID | 123827297 |
| Molecular Formula | C19H40 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 268.31 |
| IUPAC Name | 2,9,13-trimethylhexadecane |
| SMILES | CCCC(C)CCCC(C)CCCCCCC(C)C |
| InChI | InChI=1S/C19H40/c1-6-12-18(4)15-11-16-19(5)14-10-8-7-9-13-17(2)3/h17-19H,6-16H2,1-5H3 |
| InChIKey | RTFBHSQKDLWDAS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|