About 2,6-dimethyltridecane
2,6-dimethyltridecane (PubChem CID 524061) has the molecular formula C15H32
and a molecular weight of 212.42 g/mol. Its IUPAC name is 2,6-dimethyltridecane.
Molecular Properties
| Compound Name | 2,6-dimethyltridecane |
| PubChem CID | 524061 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | 2,6-dimethyltridecane |
| SMILES | CCCCCCCC(C)CCCC(C)C |
| InChI | InChI=1S/C15H32/c1-5-6-7-8-9-12-15(4)13-10-11-14(2)3/h14-15H,5-13H2,1-4H3 |
| InChIKey | JIQUCMXOBFLKIM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyltridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyltridecane?
The IUPAC name of 2,6-dimethyltridecane (CID 524061) is 2,6-dimethyltridecane.
What is the SMILES notation for 2,6-dimethyltridecane?
The canonical SMILES for 2,6-dimethyltridecane is CCCCCCCC(C)CCCC(C)C.
What is the InChIKey of 2,6-dimethyltridecane?
The InChIKey is JIQUCMXOBFLKIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32/c1-5-6-7-8-9-12-15(4)13-10-11-14(2)3/h14-15H,5-13H2,1-4H3.
What are the key properties of 2,6-dimethyltridecane?
2,6-dimethyltridecane has a molecular weight of 212.42 g/mol, XLogP of 5.81, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyltridecane is sourced from PubChem (CID 524061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).