C29H60 — CID 6428632
2,6,10,14,19-pentamethyltetracosane (PubChem CID 6428632) has the molecular formula C29H60 and a molecular weight of 408.80 g/mol. Its IUPAC name is 2,6,10,14,19-pentamethyltetracosane.
| Compound Name | 2,6,10,14,19-pentamethyltetracosane |
|---|---|
| PubChem CID | 6428632 |
| Molecular Formula | C29H60 |
| Molecular Weight | 408.80 g/mol |
| Exact Mass | 408.47 |
| IUPAC Name | 2,6,10,14,19-pentamethyltetracosane |
| SMILES | CCCCCC(C)CCCCC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C29H60/c1-8-9-10-17-26(4)18-11-12-19-27(5)21-14-23-29(7)24-15-22-28(6)20-13-16-25(2)3/h25-29H,8-24H2,1-7H3 |
| InChIKey | YCDUQPPJIYTIJD-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.80 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|