C32H66 — CID 6428620
2,6,10,14,19,23-hexamethylhexacosane (PubChem CID 6428620) has the molecular formula C32H66 and a molecular weight of 450.88 g/mol. Its IUPAC name is 2,6,10,14,19,23-hexamethylhexacosane.
| Compound Name | 2,6,10,14,19,23-hexamethylhexacosane |
|---|---|
| PubChem CID | 6428620 |
| Molecular Formula | C32H66 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.52 |
| IUPAC Name | 2,6,10,14,19,23-hexamethylhexacosane |
| SMILES | CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C32H66/c1-9-16-28(4)21-13-22-29(5)18-10-11-19-30(6)23-14-25-32(8)26-15-24-31(7)20-12-17-27(2)3/h27-32H,9-26H2,1-8H3 |
| InChIKey | ZEPYTFPGKAZHKE-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|