About 2-methyloctane;4-methyloctane;nonane
2-methyloctane;4-methyloctane;nonane (PubChem CID 160563952) has the molecular formula C27H60
and a molecular weight of 384.78 g/mol. Its IUPAC name is 2-methyloctane;4-methyloctane;nonane.
Molecular Properties
| Compound Name | 2-methyloctane;4-methyloctane;nonane |
| PubChem CID | 160563952 |
| Molecular Formula | C27H60 |
| Molecular Weight | 384.78 g/mol |
| Exact Mass | 384.47 |
| IUPAC Name | 2-methyloctane;4-methyloctane;nonane |
| SMILES | CCCCC(C)CCC.CCCCCCC(C)C.CCCCCCCCC |
| InChI | InChI=1S/3C9H20/c1-4-5-6-7-8-9(2)3;1-4-6-8-9(3)7-5-2;1-3-5-7-9-8-6-4-2/h2*9H,4-8H2,1-3H3;3-9H2,1-2H3 |
| InChIKey | QZRIJARQRCNBJX-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.78 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloctane;4-methyloctane;nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloctane;4-methyloctane;nonane?
The IUPAC name of 2-methyloctane;4-methyloctane;nonane (CID 160563952) is 2-methyloctane;4-methyloctane;nonane.
What is the SMILES notation for 2-methyloctane;4-methyloctane;nonane?
The canonical SMILES for 2-methyloctane;4-methyloctane;nonane is CCCCC(C)CCC.CCCCCCC(C)C.CCCCCCCCC.
What is the InChIKey of 2-methyloctane;4-methyloctane;nonane?
The InChIKey is QZRIJARQRCNBJX-UHFFFAOYSA-N. The full InChI is InChI=1S/3C9H20/c1-4-5-6-7-8-9(2)3;1-4-6-8-9(3)7-5-2;1-3-5-7-9-8-6-4-2/h2*9H,4-8H2,1-3H3;3-9H2,1-2H3.
What are the key properties of 2-methyloctane;4-methyloctane;nonane?
2-methyloctane;4-methyloctane;nonane has a molecular weight of 384.78 g/mol, XLogP of 10.98, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloctane;4-methyloctane;nonane is sourced from PubChem (CID 160563952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).