About 4,13-dimethylheptadecane
4,13-dimethylheptadecane (PubChem CID 6430494) has the molecular formula C19H40
and a molecular weight of 268.53 g/mol. Its IUPAC name is 4,13-dimethylheptadecane.
Molecular Properties
| Compound Name | 4,13-dimethylheptadecane |
| PubChem CID | 6430494 |
| Molecular Formula | C19H40 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 268.31 |
| IUPAC Name | 4,13-dimethylheptadecane |
| SMILES | CCCCC(C)CCCCCCCCC(C)CCC |
| InChI | InChI=1S/C19H40/c1-5-7-15-19(4)17-13-11-9-8-10-12-16-18(3)14-6-2/h18-19H,5-17H2,1-4H3 |
| InChIKey | YFHUMDPIGZFTRU-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,13-dimethylheptadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,13-dimethylheptadecane?
The IUPAC name of 4,13-dimethylheptadecane (CID 6430494) is 4,13-dimethylheptadecane.
What is the SMILES notation for 4,13-dimethylheptadecane?
The canonical SMILES for 4,13-dimethylheptadecane is CCCCC(C)CCCCCCCCC(C)CCC.
What is the InChIKey of 4,13-dimethylheptadecane?
The InChIKey is YFHUMDPIGZFTRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40/c1-5-7-15-19(4)17-13-11-9-8-10-12-16-18(3)14-6-2/h18-19H,5-17H2,1-4H3.
What are the key properties of 4,13-dimethylheptadecane?
4,13-dimethylheptadecane has a molecular weight of 268.53 g/mol, XLogP of 7.37, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,13-dimethylheptadecane is sourced from PubChem (CID 6430494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).