About (4R)-4-methyldecane
(4R)-4-methyldecane (PubChem CID 57191620) has the molecular formula C11H24
and a molecular weight of 156.31 g/mol. Its IUPAC name is (4R)-4-methyldecane.
Molecular Properties
| Compound Name | (4R)-4-methyldecane |
| PubChem CID | 57191620 |
| Molecular Formula | C11H24 |
| Molecular Weight | 156.31 g/mol |
| Exact Mass | 156.19 |
| IUPAC Name | (4R)-4-methyldecane |
| SMILES | CCCCCC[C@H](C)CCC |
| InChI | InChI=1S/C11H24/c1-4-6-7-8-10-11(3)9-5-2/h11H,4-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | DVWZNKLWPILULD-LLVKDONJSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-methyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-methyldecane?
The IUPAC name of (4R)-4-methyldecane (CID 57191620) is (4R)-4-methyldecane.
What is the SMILES notation for (4R)-4-methyldecane?
The canonical SMILES for (4R)-4-methyldecane is CCCCCC[C@H](C)CCC.
What is the InChIKey of (4R)-4-methyldecane?
The InChIKey is DVWZNKLWPILULD-LLVKDONJSA-N. The full InChI is InChI=1S/C11H24/c1-4-6-7-8-10-11(3)9-5-2/h11H,4-10H2,1-3H3/t11-/m1/s1.
What are the key properties of (4R)-4-methyldecane?
(4R)-4-methyldecane has a molecular weight of 156.31 g/mol, XLogP of 4.39, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-methyldecane is sourced from PubChem (CID 57191620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).