About 4,9-dimethylpentadecane
4,9-dimethylpentadecane (PubChem CID 123851930) has the molecular formula C17H36
and a molecular weight of 240.47 g/mol. Its IUPAC name is 4,9-dimethylpentadecane.
Molecular Properties
| Compound Name | 4,9-dimethylpentadecane |
| PubChem CID | 123851930 |
| Molecular Formula | C17H36 |
| Molecular Weight | 240.47 g/mol |
| Exact Mass | 240.28 |
| IUPAC Name | 4,9-dimethylpentadecane |
| SMILES | CCCCCCC(C)CCCCC(C)CCC |
| InChI | InChI=1S/C17H36/c1-5-7-8-9-13-17(4)15-11-10-14-16(3)12-6-2/h16-17H,5-15H2,1-4H3 |
| InChIKey | ODXXKLHRUWQELC-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.47 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,9-dimethylpentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-dimethylpentadecane?
The IUPAC name of 4,9-dimethylpentadecane (CID 123851930) is 4,9-dimethylpentadecane.
What is the SMILES notation for 4,9-dimethylpentadecane?
The canonical SMILES for 4,9-dimethylpentadecane is CCCCCCC(C)CCCCC(C)CCC.
What is the InChIKey of 4,9-dimethylpentadecane?
The InChIKey is ODXXKLHRUWQELC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36/c1-5-7-8-9-13-17(4)15-11-10-14-16(3)12-6-2/h16-17H,5-15H2,1-4H3.
What are the key properties of 4,9-dimethylpentadecane?
4,9-dimethylpentadecane has a molecular weight of 240.47 g/mol, XLogP of 6.59, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-dimethylpentadecane is sourced from PubChem (CID 123851930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).