C26H54 — CID 6428617
2,6,10,15,19-pentamethylhenicosane (PubChem CID 6428617) has the molecular formula C26H54 and a molecular weight of 366.72 g/mol. Its IUPAC name is 2,6,10,15,19-pentamethylhenicosane.
| Compound Name | 2,6,10,15,19-pentamethylhenicosane |
|---|---|
| PubChem CID | 6428617 |
| Molecular Formula | C26H54 |
| Molecular Weight | 366.72 g/mol |
| Exact Mass | 366.42 |
| IUPAC Name | 2,6,10,15,19-pentamethylhenicosane |
| SMILES | CCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C26H54/c1-8-23(4)17-12-19-24(5)15-9-10-16-25(6)20-13-21-26(7)18-11-14-22(2)3/h22-26H,8-21H2,1-7H3 |
| InChIKey | GNBIPBDUVGSNTO-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.72 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|