About 2-methyldecane;3-methylheptane;3-methylundecane
2-methyldecane;3-methylheptane;3-methylundecane (PubChem CID 91314766) has the molecular formula C31H68
and a molecular weight of 440.89 g/mol. Its IUPAC name is 2-methyldecane;3-methylheptane;3-methylundecane.
Molecular Properties
| Compound Name | 2-methyldecane;3-methylheptane;3-methylundecane |
| PubChem CID | 91314766 |
| Molecular Formula | C31H68 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.53 |
| IUPAC Name | 2-methyldecane;3-methylheptane;3-methylundecane |
| SMILES | CCCCC(C)CC.CCCCCCCCC(C)C.CCCCCCCCC(C)CC |
| InChI | InChI=1S/C12H26.C11H24.C8H18/c1-4-6-7-8-9-10-11-12(3)5-2;1-4-5-6-7-8-9-10-11(2)3;1-4-6-7-8(3)5-2/h12H,4-11H2,1-3H3;11H,4-10H2,1-3H3;8H,4-7H2,1-3H3 |
| InChIKey | IBVUBSTXNIGYEO-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyldecane;3-methylheptane;3-methylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyldecane;3-methylheptane;3-methylundecane?
The IUPAC name of 2-methyldecane;3-methylheptane;3-methylundecane (CID 91314766) is 2-methyldecane;3-methylheptane;3-methylundecane.
What is the SMILES notation for 2-methyldecane;3-methylheptane;3-methylundecane?
The canonical SMILES for 2-methyldecane;3-methylheptane;3-methylundecane is CCCCC(C)CC.CCCCCCCCC(C)C.CCCCCCCCC(C)CC.
What is the InChIKey of 2-methyldecane;3-methylheptane;3-methylundecane?
The InChIKey is IBVUBSTXNIGYEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26.C11H24.C8H18/c1-4-6-7-8-9-10-11-12(3)5-2;1-4-5-6-7-8-9-10-11(2)3;1-4-6-7-8(3)5-2/h12H,4-11H2,1-3H3;11H,4-10H2,1-3H3;8H,4-7H2,1-3H3.
What are the key properties of 2-methyldecane;3-methylheptane;3-methylundecane?
2-methyldecane;3-methylheptane;3-methylundecane has a molecular weight of 440.89 g/mol, XLogP of 12.40, 19 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyldecane;3-methylheptane;3-methylundecane is sourced from PubChem (CID 91314766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).