About hexane;3-methylnonane
hexane;3-methylnonane (PubChem CID 173294071) has the molecular formula C16H36
and a molecular weight of 228.46 g/mol. Its IUPAC name is hexane;3-methylnonane.
Molecular Properties
| Compound Name | hexane;3-methylnonane |
| PubChem CID | 173294071 |
| Molecular Formula | C16H36 |
| Molecular Weight | 228.46 g/mol |
| Exact Mass | 228.28 |
| IUPAC Name | hexane;3-methylnonane |
| SMILES | CCCCCC.CCCCCCC(C)CC |
| InChI | InChI=1S/C10H22.C6H14/c1-4-6-7-8-9-10(3)5-2;1-3-5-6-4-2/h10H,4-9H2,1-3H3;3-6H2,1-2H3 |
| InChIKey | AFNHOFZKDSQQRO-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.46 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexane;3-methylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;3-methylnonane?
The IUPAC name of hexane;3-methylnonane (CID 173294071) is hexane;3-methylnonane.
What is the SMILES notation for hexane;3-methylnonane?
The canonical SMILES for hexane;3-methylnonane is CCCCCC.CCCCCCC(C)CC.
What is the InChIKey of hexane;3-methylnonane?
The InChIKey is AFNHOFZKDSQQRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22.C6H14/c1-4-6-7-8-9-10(3)5-2;1-3-5-6-4-2/h10H,4-9H2,1-3H3;3-6H2,1-2H3.
What are the key properties of hexane;3-methylnonane?
hexane;3-methylnonane has a molecular weight of 228.46 g/mol, XLogP of 6.59, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;3-methylnonane is sourced from PubChem (CID 173294071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).