About azane;3-methylnonane
azane;3-methylnonane (PubChem CID 88699159) has the molecular formula C10H25N
and a molecular weight of 159.32 g/mol. Its IUPAC name is azane;3-methylnonane.
Molecular Properties
| Compound Name | azane;3-methylnonane |
| PubChem CID | 88699159 |
| Molecular Formula | C10H25N |
| Molecular Weight | 159.32 g/mol |
| Exact Mass | 159.20 |
| IUPAC Name | azane;3-methylnonane |
| SMILES | CCCCCCC(C)CC.N |
| InChI | InChI=1S/C10H22.H3N/c1-4-6-7-8-9-10(3)5-2;/h10H,4-9H2,1-3H3;1H3 |
| InChIKey | LIZPMWJYQHWNJO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;3-methylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-methylnonane?
The IUPAC name of azane;3-methylnonane (CID 88699159) is azane;3-methylnonane.
What is the SMILES notation for azane;3-methylnonane?
The canonical SMILES for azane;3-methylnonane is CCCCCCC(C)CC.N.
What is the InChIKey of azane;3-methylnonane?
The InChIKey is LIZPMWJYQHWNJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22.H3N/c1-4-6-7-8-9-10(3)5-2;/h10H,4-9H2,1-3H3;1H3.
What are the key properties of azane;3-methylnonane?
azane;3-methylnonane has a molecular weight of 159.32 g/mol, XLogP of 4.16, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-methylnonane is sourced from PubChem (CID 88699159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).