C25H52 — CID 163011810
(3R,11S)-3,11-dimethyltricosane (PubChem CID 163011810) has the molecular formula C25H52 and a molecular weight of 352.69 g/mol. Its IUPAC name is (3R,11S)-3,11-dimethyltricosane.
| Compound Name | (3R,11S)-3,11-dimethyltricosane |
|---|---|
| PubChem CID | 163011810 |
| Molecular Formula | C25H52 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 352.41 |
| IUPAC Name | (3R,11S)-3,11-dimethyltricosane |
| SMILES | CCCCCCCCCCCC[C@H](C)CCCCCCC[C@H](C)CC |
| InChI | InChI=1S/C25H52/c1-5-7-8-9-10-11-12-13-15-19-22-25(4)23-20-17-14-16-18-21-24(3)6-2/h24-25H,5-23H2,1-4H3/t24-,25+/m1/s1 |
| InChIKey | DOKZTNHNVIATRD-RPBOFIJWSA-N |
| XLogP | 9.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|