About (3R)-3-methyloctadecane
(3R)-3-methyloctadecane (PubChem CID 98094048) has the molecular formula C19H40
and a molecular weight of 268.53 g/mol. Its IUPAC name is (3R)-3-methyloctadecane.
Molecular Properties
| Compound Name | (3R)-3-methyloctadecane |
| PubChem CID | 98094048 |
| Molecular Formula | C19H40 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 268.31 |
| IUPAC Name | (3R)-3-methyloctadecane |
| SMILES | CCCCCCCCCCCCCCC[C@H](C)CC |
| InChI | InChI=1S/C19H40/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19(3)5-2/h19H,4-18H2,1-3H3/t19-/m1/s1 |
| InChIKey | PGZRTPKNSFMAOP-LJQANCHMSA-N |
| XLogP | 7.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-methyloctadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-methyloctadecane?
The IUPAC name of (3R)-3-methyloctadecane (CID 98094048) is (3R)-3-methyloctadecane.
What is the SMILES notation for (3R)-3-methyloctadecane?
The canonical SMILES for (3R)-3-methyloctadecane is CCCCCCCCCCCCCCC[C@H](C)CC.
What is the InChIKey of (3R)-3-methyloctadecane?
The InChIKey is PGZRTPKNSFMAOP-LJQANCHMSA-N. The full InChI is InChI=1S/C19H40/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19(3)5-2/h19H,4-18H2,1-3H3/t19-/m1/s1.
What are the key properties of (3R)-3-methyloctadecane?
(3R)-3-methyloctadecane has a molecular weight of 268.53 g/mol, XLogP of 7.51, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-methyloctadecane is sourced from PubChem (CID 98094048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).