About methane;3-methyltridecane
methane;3-methyltridecane (PubChem CID 161019087) has the molecular formula C16H38
and a molecular weight of 230.48 g/mol. Its IUPAC name is methane;3-methyltridecane.
Molecular Properties
| Compound Name | methane;3-methyltridecane |
| PubChem CID | 161019087 |
| Molecular Formula | C16H38 |
| Molecular Weight | 230.48 g/mol |
| Exact Mass | 230.30 |
| IUPAC Name | methane;3-methyltridecane |
| SMILES | C.C.CCCCCCCCCCC(C)CC |
| InChI | InChI=1S/C14H30.2CH4/c1-4-6-7-8-9-10-11-12-13-14(3)5-2;;/h14H,4-13H2,1-3H3;2*1H4 |
| InChIKey | TYCTZFQQRUCWLV-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 230.48 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;3-methyltridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-methyltridecane?
The IUPAC name of methane;3-methyltridecane (CID 161019087) is methane;3-methyltridecane.
What is the SMILES notation for methane;3-methyltridecane?
The canonical SMILES for methane;3-methyltridecane is C.C.CCCCCCCCCCC(C)CC.
What is the InChIKey of methane;3-methyltridecane?
The InChIKey is TYCTZFQQRUCWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30.2CH4/c1-4-6-7-8-9-10-11-12-13-14(3)5-2;;/h14H,4-13H2,1-3H3;2*1H4.
What are the key properties of methane;3-methyltridecane?
methane;3-methyltridecane has a molecular weight of 230.48 g/mol, XLogP of 6.84, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-methyltridecane is sourced from PubChem (CID 161019087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).