C11H24 — CID 42626759
(3R,7R)-3,7-dimethylnonane (PubChem CID 42626759) has the molecular formula C11H24 and a molecular weight of 156.31 g/mol. Its IUPAC name is (3R,7R)-3,7-dimethylnonane.
| Compound Name | (3R,7R)-3,7-dimethylnonane |
|---|---|
| PubChem CID | 42626759 |
| Molecular Formula | C11H24 |
| Molecular Weight | 156.31 g/mol |
| Exact Mass | 156.19 |
| IUPAC Name | (3R,7R)-3,7-dimethylnonane |
| SMILES | CC[C@@H](C)CCC[C@H](C)CC |
| InChI | InChI=1S/C11H24/c1-5-10(3)8-7-9-11(4)6-2/h10-11H,5-9H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | YGPVLXJHRFZYJJ-GHMZBOCLSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |