About 3-ethyl-7-methylnonane
3-ethyl-7-methylnonane (PubChem CID 526426) has the molecular formula C12H26
and a molecular weight of 170.34 g/mol. Its IUPAC name is 3-ethyl-7-methylnonane.
Molecular Properties
| Compound Name | 3-ethyl-7-methylnonane |
| PubChem CID | 526426 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | 3-ethyl-7-methylnonane |
| SMILES | CCC(C)CCCC(CC)CC |
| InChI | InChI=1S/C12H26/c1-5-11(4)9-8-10-12(6-2)7-3/h11-12H,5-10H2,1-4H3 |
| InChIKey | FSGFZSLYTXQNCW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethyl-7-methylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-7-methylnonane?
The IUPAC name of 3-ethyl-7-methylnonane (CID 526426) is 3-ethyl-7-methylnonane.
What is the SMILES notation for 3-ethyl-7-methylnonane?
The canonical SMILES for 3-ethyl-7-methylnonane is CCC(C)CCCC(CC)CC.
What is the InChIKey of 3-ethyl-7-methylnonane?
The InChIKey is FSGFZSLYTXQNCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26/c1-5-11(4)9-8-10-12(6-2)7-3/h11-12H,5-10H2,1-4H3.
What are the key properties of 3-ethyl-7-methylnonane?
3-ethyl-7-methylnonane has a molecular weight of 170.34 g/mol, XLogP of 4.64, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-7-methylnonane is sourced from PubChem (CID 526426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).