About 13-ethyl-3,8-dimethyloctadecane
13-ethyl-3,8-dimethyloctadecane (PubChem CID 123214629) has the molecular formula C22H46
and a molecular weight of 310.61 g/mol. Its IUPAC name is 13-ethyl-3,8-dimethyloctadecane.
Molecular Properties
| Compound Name | 13-ethyl-3,8-dimethyloctadecane |
| PubChem CID | 123214629 |
| Molecular Formula | C22H46 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 310.36 |
| IUPAC Name | 13-ethyl-3,8-dimethyloctadecane |
| SMILES | CCCCCC(CC)CCCCC(C)CCCCC(C)CC |
| InChI | InChI=1S/C22H46/c1-6-9-10-18-22(8-3)19-14-13-17-21(5)16-12-11-15-20(4)7-2/h20-22H,6-19H2,1-5H3 |
| InChIKey | SWNIOTSCPDJLCA-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 13-ethyl-3,8-dimethyloctadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-ethyl-3,8-dimethyloctadecane?
The IUPAC name of 13-ethyl-3,8-dimethyloctadecane (CID 123214629) is 13-ethyl-3,8-dimethyloctadecane.
What is the SMILES notation for 13-ethyl-3,8-dimethyloctadecane?
The canonical SMILES for 13-ethyl-3,8-dimethyloctadecane is CCCCCC(CC)CCCCC(C)CCCCC(C)CC.
What is the InChIKey of 13-ethyl-3,8-dimethyloctadecane?
The InChIKey is SWNIOTSCPDJLCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46/c1-6-9-10-18-22(8-3)19-14-13-17-21(5)16-12-11-15-20(4)7-2/h20-22H,6-19H2,1-5H3.
What are the key properties of 13-ethyl-3,8-dimethyloctadecane?
13-ethyl-3,8-dimethyloctadecane has a molecular weight of 310.61 g/mol, XLogP of 8.40, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 13-ethyl-3,8-dimethyloctadecane is sourced from PubChem (CID 123214629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).