About 3-ethyl-6,11-dimethyltridecane
3-ethyl-6,11-dimethyltridecane (PubChem CID 123237146) has the molecular formula C17H36
and a molecular weight of 240.47 g/mol. Its IUPAC name is 3-ethyl-6,11-dimethyltridecane.
Molecular Properties
| Compound Name | 3-ethyl-6,11-dimethyltridecane |
| PubChem CID | 123237146 |
| Molecular Formula | C17H36 |
| Molecular Weight | 240.47 g/mol |
| Exact Mass | 240.28 |
| IUPAC Name | 3-ethyl-6,11-dimethyltridecane |
| SMILES | CCC(C)CCCCC(C)CCC(CC)CC |
| InChI | InChI=1S/C17H36/c1-6-15(4)11-9-10-12-16(5)13-14-17(7-2)8-3/h15-17H,6-14H2,1-5H3 |
| InChIKey | JXZMUBWDVPXANT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.47 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-6,11-dimethyltridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6,11-dimethyltridecane?
The IUPAC name of 3-ethyl-6,11-dimethyltridecane (CID 123237146) is 3-ethyl-6,11-dimethyltridecane.
What is the SMILES notation for 3-ethyl-6,11-dimethyltridecane?
The canonical SMILES for 3-ethyl-6,11-dimethyltridecane is CCC(C)CCCCC(C)CCC(CC)CC.
What is the InChIKey of 3-ethyl-6,11-dimethyltridecane?
The InChIKey is JXZMUBWDVPXANT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36/c1-6-15(4)11-9-10-12-16(5)13-14-17(7-2)8-3/h15-17H,6-14H2,1-5H3.
What are the key properties of 3-ethyl-6,11-dimethyltridecane?
3-ethyl-6,11-dimethyltridecane has a molecular weight of 240.47 g/mol, XLogP of 6.45, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6,11-dimethyltridecane is sourced from PubChem (CID 123237146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).