C12H26 — CID 170848353
(3R,6S)-3,6-dimethyldecane (PubChem CID 170848353) has the molecular formula C12H26 and a molecular weight of 170.34 g/mol. Its IUPAC name is (3R,6S)-3,6-dimethyldecane.
| Compound Name | (3R,6S)-3,6-dimethyldecane |
|---|---|
| PubChem CID | 170848353 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | (3R,6S)-3,6-dimethyldecane |
| SMILES | CCCC[C@H](C)CC[C@H](C)CC |
| InChI | InChI=1S/C12H26/c1-5-7-8-12(4)10-9-11(3)6-2/h11-12H,5-10H2,1-4H3/t11-,12+/m1/s1 |
| InChIKey | NQWFSCYWTXQNGG-NEPJUHHUSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |