About calcium;hydride;3-methylheptane
calcium;hydride;3-methylheptane (PubChem CID 174879723) has the molecular formula C8H20Ca
and a molecular weight of 156.33 g/mol. Its IUPAC name is calcium;hydride;3-methylheptane.
Molecular Properties
| Compound Name | calcium;hydride;3-methylheptane |
| PubChem CID | 174879723 |
| Molecular Formula | C8H20Ca |
| Molecular Weight | 156.33 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | calcium;hydride;3-methylheptane |
| SMILES | CCCCC(C)CC.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C8H18.Ca.2H/c1-4-6-7-8(3)5-2;;;/h8H,4-7H2,1-3H3;;;/q;+2;2*-1 |
| InChIKey | UDXSKGBZEHBUMH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze calcium;hydride;3-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;3-methylheptane?
The IUPAC name of calcium;hydride;3-methylheptane (CID 174879723) is calcium;hydride;3-methylheptane.
What is the SMILES notation for calcium;hydride;3-methylheptane?
The canonical SMILES for calcium;hydride;3-methylheptane is CCCCC(C)CC.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;3-methylheptane?
The InChIKey is UDXSKGBZEHBUMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.Ca.2H/c1-4-6-7-8(3)5-2;;;/h8H,4-7H2,1-3H3;;;/q;+2;2*-1.
What are the key properties of calcium;hydride;3-methylheptane?
calcium;hydride;3-methylheptane has a molecular weight of 156.33 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;3-methylheptane is sourced from PubChem (CID 174879723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).