About 3-methylheptane;nickel
3-methylheptane;nickel (PubChem CID 158967838) has the molecular formula C8H18Ni
and a molecular weight of 172.92 g/mol. Its IUPAC name is 3-methylheptane;nickel.
Molecular Properties
| Compound Name | 3-methylheptane;nickel |
| PubChem CID | 158967838 |
| Molecular Formula | C8H18Ni |
| Molecular Weight | 172.92 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 3-methylheptane;nickel |
| SMILES | CCCCC(C)CC.[Ni] |
| InChI | InChI=1S/C8H18.Ni/c1-4-6-7-8(3)5-2;/h8H,4-7H2,1-3H3; |
| InChIKey | JNKWVZSYYAXIAR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.92 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methylheptane;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylheptane;nickel?
The IUPAC name of 3-methylheptane;nickel (CID 158967838) is 3-methylheptane;nickel.
What is the SMILES notation for 3-methylheptane;nickel?
The canonical SMILES for 3-methylheptane;nickel is CCCCC(C)CC.[Ni].
What is the InChIKey of 3-methylheptane;nickel?
The InChIKey is JNKWVZSYYAXIAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.Ni/c1-4-6-7-8(3)5-2;/h8H,4-7H2,1-3H3;.
What are the key properties of 3-methylheptane;nickel?
3-methylheptane;nickel has a molecular weight of 172.92 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylheptane;nickel is sourced from PubChem (CID 158967838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).