About 3-methylheptane;oxotitanium
3-methylheptane;oxotitanium (PubChem CID 174602327) has the molecular formula C8H18OTi
and a molecular weight of 178.10 g/mol. Its IUPAC name is 3-methylheptane;oxotitanium.
Molecular Properties
| Compound Name | 3-methylheptane;oxotitanium |
| PubChem CID | 174602327 |
| Molecular Formula | C8H18OTi |
| Molecular Weight | 178.10 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 3-methylheptane;oxotitanium |
| SMILES | CCCCC(C)CC.O=[Ti] |
| InChI | InChI=1S/C8H18.O.Ti/c1-4-6-7-8(3)5-2;;/h8H,4-7H2,1-3H3;; |
| InChIKey | BRUBMTBZQJHXLI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.10 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylheptane;oxotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylheptane;oxotitanium?
The IUPAC name of 3-methylheptane;oxotitanium (CID 174602327) is 3-methylheptane;oxotitanium.
What is the SMILES notation for 3-methylheptane;oxotitanium?
The canonical SMILES for 3-methylheptane;oxotitanium is CCCCC(C)CC.O=[Ti].
What is the InChIKey of 3-methylheptane;oxotitanium?
The InChIKey is BRUBMTBZQJHXLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.O.Ti/c1-4-6-7-8(3)5-2;;/h8H,4-7H2,1-3H3;;.
What are the key properties of 3-methylheptane;oxotitanium?
3-methylheptane;oxotitanium has a molecular weight of 178.10 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylheptane;oxotitanium is sourced from PubChem (CID 174602327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).