About 4-ethylheptane;3-methylheptane
4-ethylheptane;3-methylheptane (PubChem CID 143099611) has the molecular formula C17H38
and a molecular weight of 242.49 g/mol. Its IUPAC name is 4-ethylheptane;3-methylheptane.
Molecular Properties
| Compound Name | 4-ethylheptane;3-methylheptane |
| PubChem CID | 143099611 |
| Molecular Formula | C17H38 |
| Molecular Weight | 242.49 g/mol |
| Exact Mass | 242.30 |
| IUPAC Name | 4-ethylheptane;3-methylheptane |
| SMILES | CCCC(CC)CCC.CCCCC(C)CC |
| InChI | InChI=1S/C9H20.C8H18/c1-4-7-9(6-3)8-5-2;1-4-6-7-8(3)5-2/h9H,4-8H2,1-3H3;8H,4-7H2,1-3H3 |
| InChIKey | MENPOKPUNIKVJX-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.49 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-ethylheptane;3-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylheptane;3-methylheptane?
The IUPAC name of 4-ethylheptane;3-methylheptane (CID 143099611) is 4-ethylheptane;3-methylheptane.
What is the SMILES notation for 4-ethylheptane;3-methylheptane?
The canonical SMILES for 4-ethylheptane;3-methylheptane is CCCC(CC)CCC.CCCCC(C)CC.
What is the InChIKey of 4-ethylheptane;3-methylheptane?
The InChIKey is MENPOKPUNIKVJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20.C8H18/c1-4-7-9(6-3)8-5-2;1-4-6-7-8(3)5-2/h9H,4-8H2,1-3H3;8H,4-7H2,1-3H3.
What are the key properties of 4-ethylheptane;3-methylheptane?
4-ethylheptane;3-methylheptane has a molecular weight of 242.49 g/mol, XLogP of 6.84, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylheptane;3-methylheptane is sourced from PubChem (CID 143099611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).