About 6-ethyl-3-methylnonane;methane
6-ethyl-3-methylnonane;methane (PubChem CID 142358245) has the molecular formula C13H30
and a molecular weight of 186.38 g/mol. Its IUPAC name is 6-ethyl-3-methylnonane;methane.
Molecular Properties
| Compound Name | 6-ethyl-3-methylnonane;methane |
| PubChem CID | 142358245 |
| Molecular Formula | C13H30 |
| Molecular Weight | 186.38 g/mol |
| Exact Mass | 186.23 |
| IUPAC Name | 6-ethyl-3-methylnonane;methane |
| SMILES | C.CCCC(CC)CCC(C)CC |
| InChI | InChI=1S/C12H26.CH4/c1-5-8-12(7-3)10-9-11(4)6-2;/h11-12H,5-10H2,1-4H3;1H4 |
| InChIKey | QPLDZGYWTYCMLB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 186.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-ethyl-3-methylnonane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3-methylnonane;methane?
The IUPAC name of 6-ethyl-3-methylnonane;methane (CID 142358245) is 6-ethyl-3-methylnonane;methane.
What is the SMILES notation for 6-ethyl-3-methylnonane;methane?
The canonical SMILES for 6-ethyl-3-methylnonane;methane is C.CCCC(CC)CCC(C)CC.
What is the InChIKey of 6-ethyl-3-methylnonane;methane?
The InChIKey is QPLDZGYWTYCMLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26.CH4/c1-5-8-12(7-3)10-9-11(4)6-2;/h11-12H,5-10H2,1-4H3;1H4.
What are the key properties of 6-ethyl-3-methylnonane;methane?
6-ethyl-3-methylnonane;methane has a molecular weight of 186.38 g/mol, XLogP of 5.28, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3-methylnonane;methane is sourced from PubChem (CID 142358245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).