About 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane
3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane (PubChem CID 158040409) has the molecular formula C34H84O
and a molecular weight of 509.05 g/mol. Its IUPAC name is 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane.
Molecular Properties
| Compound Name | 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane |
| PubChem CID | 158040409 |
| Molecular Formula | C34H84O |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.65 |
| IUPAC Name | 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane |
| SMILES | CC.CC.CC.CC.CC.CC.CCC(C)CCC(C)CCO.CCCC(C)CCC(CC)CC |
| InChI | InChI=1S/C12H26.C10H22O.6C2H6/c1-5-8-11(4)9-10-12(6-2)7-3;1-4-9(2)5-6-10(3)7-8-11;6*1-2/h11-12H,5-10H2,1-4H3;9-11H,4-8H2,1-3H3;6*1-2H3 |
| InChIKey | FIHAPFVOZFUZAJ-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane?
The IUPAC name of 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane (CID 158040409) is 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane.
What is the SMILES notation for 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane?
The canonical SMILES for 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane is CC.CC.CC.CC.CC.CC.CCC(C)CCC(C)CCO.CCCC(C)CCC(CC)CC.
What is the InChIKey of 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane?
The InChIKey is FIHAPFVOZFUZAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26.C10H22O.6C2H6/c1-5-8-11(4)9-10-12(6-2)7-3;1-4-9(2)5-6-10(3)7-8-11;6*1-2/h11-12H,5-10H2,1-4H3;9-11H,4-8H2,1-3H3;6*1-2H3.
What are the key properties of 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane?
3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane has a molecular weight of 509.05 g/mol, XLogP of 13.63, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane is sourced from PubChem (CID 158040409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).