C34H84O — CID 158040409
3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane (PubChem CID 158040409) has the molecular formula C34H84O and a molecular weight of 509.05 g/mol. Its IUPAC name is 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane.
| Compound Name | 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane |
|---|---|
| PubChem CID | 158040409 |
| Molecular Formula | C34H84O |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.65 |
| IUPAC Name | 3,6-dimethyloctan-1-ol;ethane;3-ethyl-6-methylnonane |
| SMILES | CC.CC.CC.CC.CC.CC.CCC(C)CCC(C)CCO.CCCC(C)CCC(CC)CC |
| InChI | InChI=1S/C12H26.C10H22O.6C2H6/c1-5-8-11(4)9-10-12(6-2)7-3;1-4-9(2)5-6-10(3)7-8-11;6*1-2/h11-12H,5-10H2,1-4H3;9-11H,4-8H2,1-3H3;6*1-2H3 |
| InChIKey | FIHAPFVOZFUZAJ-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |