C23H56 — CID 143978343
3,6-dimethylnonane;ethane;3-methylpentane (PubChem CID 143978343) has the molecular formula C23H56 and a molecular weight of 332.70 g/mol. Its IUPAC name is 3,6-dimethylnonane;ethane;3-methylpentane.
| Compound Name | 3,6-dimethylnonane;ethane;3-methylpentane |
|---|---|
| PubChem CID | 143978343 |
| Molecular Formula | C23H56 |
| Molecular Weight | 332.70 g/mol |
| Exact Mass | 332.44 |
| IUPAC Name | 3,6-dimethylnonane;ethane;3-methylpentane |
| SMILES | CC.CC.CC.CCC(C)CC.CCCC(C)CCC(C)CC |
| InChI | InChI=1S/C11H24.C6H14.3C2H6/c1-5-7-11(4)9-8-10(3)6-2;1-4-6(3)5-2;3*1-2/h10-11H,5-9H2,1-4H3;6H,4-5H2,1-3H3;3*1-2H3 |
| InChIKey | KYXVLGWWSQAZHU-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.70 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |