C22H50 — CID 160955988
3,3-diethylpentane;3-methylhexane;3-methylpentane (PubChem CID 160955988) has the molecular formula C22H50 and a molecular weight of 314.64 g/mol. Its IUPAC name is 3,3-diethylpentane;3-methylhexane;3-methylpentane.
| Compound Name | 3,3-diethylpentane;3-methylhexane;3-methylpentane |
|---|---|
| PubChem CID | 160955988 |
| Molecular Formula | C22H50 |
| Molecular Weight | 314.64 g/mol |
| Exact Mass | 314.39 |
| IUPAC Name | 3,3-diethylpentane;3-methylhexane;3-methylpentane |
| SMILES | CCC(C)CC.CCC(CC)(CC)CC.CCCC(C)CC |
| InChI | InChI=1S/C9H20.C7H16.C6H14/c1-5-9(6-2,7-3)8-4;1-4-6-7(3)5-2;1-4-6(3)5-2/h5-8H2,1-4H3;7H,4-6H2,1-3H3;6H,4-5H2,1-3H3 |
| InChIKey | SWJVRBOVHDVCDZ-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.64 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |