C55H126 — CID 161470196
3,3-dimethylpentane;heptane;bis(hexane);2-methylheptane;3-methylheptane;3-methylhexane;3-methylpentane (PubChem CID 161470196) has the molecular formula C55H126 and a molecular weight of 787.61 g/mol. Its IUPAC name is 3,3-dimethylpentane;heptane;bis(hexane);2-methylheptane;3-methylheptane;3-methylhexane;3-methylpentane.
| Compound Name | 3,3-dimethylpentane;heptane;bis(hexane);2-methylheptane;3-methylheptane;3-methylhexane;3-methylpentane |
|---|---|
| PubChem CID | 161470196 |
| Molecular Formula | C55H126 |
| Molecular Weight | 787.61 g/mol |
| Exact Mass | 786.99 |
| IUPAC Name | 3,3-dimethylpentane;heptane;bis(hexane);2-methylheptane;3-methylheptane;3-methylhexane;3-methylpentane |
| SMILES | CCC(C)(C)CC.CCC(C)CC.CCCC(C)CC.CCCCC(C)CC.CCCCCC.CCCCCC.CCCCCC(C)C.CCCCCCC |
| InChI | InChI=1S/2C8H18.3C7H16.3C6H14/c1-4-5-6-7-8(2)3;1-4-6-7-8(3)5-2;1-5-7(3,4)6-2;1-4-6-7(3)5-2;1-3-5-7-6-4-2;1-4-6(3)5-2;2*1-3-5-6-4-2/h2*8H,4-7H2,1-3H3;5-6H2,1-4H3;7H,4-6H2,1-3H3;3-7H2,1-2H3;6H,4-5H2,1-3H3;2*3-6H2,1-2H3 |
| InChIKey | WCYXWHCZHYDYDY-UHFFFAOYSA-N |
| XLogP | 22.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 25 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.61 |
| LogP ≤ 5 | 22.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|