About 2-methylhexane;3-methylhexane
2-methylhexane;3-methylhexane (PubChem CID 123646192) has the molecular formula C14H32
and a molecular weight of 200.41 g/mol. Its IUPAC name is 2-methylhexane;3-methylhexane.
Molecular Properties
| Compound Name | 2-methylhexane;3-methylhexane |
| PubChem CID | 123646192 |
| Molecular Formula | C14H32 |
| Molecular Weight | 200.41 g/mol |
| Exact Mass | 200.25 |
| IUPAC Name | 2-methylhexane;3-methylhexane |
| SMILES | CCCC(C)CC.CCCCC(C)C |
| InChI | InChI=1S/2C7H16/c1-4-5-6-7(2)3;1-4-6-7(3)5-2/h2*7H,4-6H2,1-3H3 |
| InChIKey | WIYGJFPCTYPFLX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 200.41 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylhexane;3-methylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexane;3-methylhexane?
The IUPAC name of 2-methylhexane;3-methylhexane (CID 123646192) is 2-methylhexane;3-methylhexane.
What is the SMILES notation for 2-methylhexane;3-methylhexane?
The canonical SMILES for 2-methylhexane;3-methylhexane is CCCC(C)CC.CCCCC(C)C.
What is the InChIKey of 2-methylhexane;3-methylhexane?
The InChIKey is WIYGJFPCTYPFLX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H16/c1-4-5-6-7(2)3;1-4-6-7(3)5-2/h2*7H,4-6H2,1-3H3.
What are the key properties of 2-methylhexane;3-methylhexane?
2-methylhexane;3-methylhexane has a molecular weight of 200.41 g/mol, XLogP of 5.67, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexane;3-methylhexane is sourced from PubChem (CID 123646192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).