About methane;2-methylbutane;2-methylhexane
methane;2-methylbutane;2-methylhexane (PubChem CID 167665387) has the molecular formula C16H44
and a molecular weight of 236.53 g/mol. Its IUPAC name is methane;2-methylbutane;2-methylhexane.
Molecular Properties
| Compound Name | methane;2-methylbutane;2-methylhexane |
| PubChem CID | 167665387 |
| Molecular Formula | C16H44 |
| Molecular Weight | 236.53 g/mol |
| Exact Mass | 236.34 |
| IUPAC Name | methane;2-methylbutane;2-methylhexane |
| SMILES | C.C.C.C.CCC(C)C.CCCCC(C)C |
| InChI | InChI=1S/C7H16.C5H12.4CH4/c1-4-5-6-7(2)3;1-4-5(2)3;;;;/h7H,4-6H2,1-3H3;5H,4H2,1-3H3;4*1H4 |
| InChIKey | SOFPNEKOKOVLSI-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.53 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;2-methylbutane;2-methylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylbutane;2-methylhexane?
The IUPAC name of methane;2-methylbutane;2-methylhexane (CID 167665387) is methane;2-methylbutane;2-methylhexane.
What is the SMILES notation for methane;2-methylbutane;2-methylhexane?
The canonical SMILES for methane;2-methylbutane;2-methylhexane is C.C.C.C.CCC(C)C.CCCCC(C)C.
What is the InChIKey of methane;2-methylbutane;2-methylhexane?
The InChIKey is SOFPNEKOKOVLSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.C5H12.4CH4/c1-4-5-6-7(2)3;1-4-5(2)3;;;;/h7H,4-6H2,1-3H3;5H,4H2,1-3H3;4*1H4.
What are the key properties of methane;2-methylbutane;2-methylhexane?
methane;2-methylbutane;2-methylhexane has a molecular weight of 236.53 g/mol, XLogP of 7.43, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylbutane;2-methylhexane is sourced from PubChem (CID 167665387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).