About CID 91544051
CID 91544051 (PubChem CID 91544051) has the molecular formula C7H18
and a molecular weight of 106.24 g/mol.
Molecular Properties
| Compound Name | CID 91544051 |
| PubChem CID | 91544051 |
| Molecular Formula | C7H18 |
| Molecular Weight | 106.24 g/mol |
| Exact Mass | 106.16 |
| IUPAC Name | — |
| SMILES | CCCCC(C)C.[3H][3H] |
| InChI | InChI=1S/C7H16.H2/c1-4-5-6-7(2)3;/h7H,4-6H2,1-3H3;1H/i;1+2T |
| InChIKey | JFZLXJRWBKSMPI-RCNZPAIWSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 91544051 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91544051?
The IUPAC name of CID 91544051 (CID 91544051) is not available.
What is the SMILES notation for CID 91544051?
The canonical SMILES for CID 91544051 is CCCCC(C)C.[3H][3H].
What is the InChIKey of CID 91544051?
The InChIKey is JFZLXJRWBKSMPI-RCNZPAIWSA-N. The full InChI is InChI=1S/C7H16.H2/c1-4-5-6-7(2)3;/h7H,4-6H2,1-3H3;1H/i;1+2T.
What are the key properties of CID 91544051?
CID 91544051 has a molecular weight of 106.24 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91544051 is sourced from PubChem (CID 91544051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).