About ethane;hexane;2-methylhexane
ethane;hexane;2-methylhexane (PubChem CID 142051007) has the molecular formula C15H36
and a molecular weight of 216.45 g/mol. Its IUPAC name is ethane;hexane;2-methylhexane.
Molecular Properties
| Compound Name | ethane;hexane;2-methylhexane |
| PubChem CID | 142051007 |
| Molecular Formula | C15H36 |
| Molecular Weight | 216.45 g/mol |
| Exact Mass | 216.28 |
| IUPAC Name | ethane;hexane;2-methylhexane |
| SMILES | CC.CCCCC(C)C.CCCCCC |
| InChI | InChI=1S/C7H16.C6H14.C2H6/c1-4-5-6-7(2)3;1-3-5-6-4-2;1-2/h7H,4-6H2,1-3H3;3-6H2,1-2H3;1-2H3 |
| InChIKey | CCIYRZJPGWYHHR-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 216.45 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;hexane;2-methylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;hexane;2-methylhexane?
The IUPAC name of ethane;hexane;2-methylhexane (CID 142051007) is ethane;hexane;2-methylhexane.
What is the SMILES notation for ethane;hexane;2-methylhexane?
The canonical SMILES for ethane;hexane;2-methylhexane is CC.CCCCC(C)C.CCCCCC.
What is the InChIKey of ethane;hexane;2-methylhexane?
The InChIKey is CCIYRZJPGWYHHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.C6H14.C2H6/c1-4-5-6-7(2)3;1-3-5-6-4-2;1-2/h7H,4-6H2,1-3H3;3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;hexane;2-methylhexane?
ethane;hexane;2-methylhexane has a molecular weight of 216.45 g/mol, XLogP of 6.45, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;hexane;2-methylhexane is sourced from PubChem (CID 142051007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).