About mercury;2-methylheptane
mercury;2-methylheptane (PubChem CID 175108338) has the molecular formula C8H18Hg
and a molecular weight of 314.82 g/mol. Its IUPAC name is mercury;2-methylheptane.
Molecular Properties
| Compound Name | mercury;2-methylheptane |
| PubChem CID | 175108338 |
| Molecular Formula | C8H18Hg |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | mercury;2-methylheptane |
| SMILES | CCCCCC(C)C.[Hg] |
| InChI | InChI=1S/C8H18.Hg/c1-4-5-6-7-8(2)3;/h8H,4-7H2,1-3H3; |
| InChIKey | FSNTVAKLZOHSPP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze mercury;2-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of mercury;2-methylheptane?
The IUPAC name of mercury;2-methylheptane (CID 175108338) is mercury;2-methylheptane.
What is the SMILES notation for mercury;2-methylheptane?
The canonical SMILES for mercury;2-methylheptane is CCCCCC(C)C.[Hg].
What is the InChIKey of mercury;2-methylheptane?
The InChIKey is FSNTVAKLZOHSPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.Hg/c1-4-5-6-7-8(2)3;/h8H,4-7H2,1-3H3;.
What are the key properties of mercury;2-methylheptane?
mercury;2-methylheptane has a molecular weight of 314.82 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for mercury;2-methylheptane is sourced from PubChem (CID 175108338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).