About alumane;2-methyldecane
alumane;2-methyldecane (PubChem CID 174844655) has the molecular formula C11H27Al
and a molecular weight of 186.32 g/mol. Its IUPAC name is alumane;2-methyldecane.
Molecular Properties
| Compound Name | alumane;2-methyldecane |
| PubChem CID | 174844655 |
| Molecular Formula | C11H27Al |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.19 |
| IUPAC Name | alumane;2-methyldecane |
| SMILES | CCCCCCCCC(C)C.[AlH3] |
| InChI | InChI=1S/C11H24.Al.3H/c1-4-5-6-7-8-9-10-11(2)3;;;;/h11H,4-10H2,1-3H3;;;; |
| InChIKey | XTLOBSRGLYRQCI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze alumane;2-methyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;2-methyldecane?
The IUPAC name of alumane;2-methyldecane (CID 174844655) is alumane;2-methyldecane.
What is the SMILES notation for alumane;2-methyldecane?
The canonical SMILES for alumane;2-methyldecane is CCCCCCCCC(C)C.[AlH3].
What is the InChIKey of alumane;2-methyldecane?
The InChIKey is XTLOBSRGLYRQCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24.Al.3H/c1-4-5-6-7-8-9-10-11(2)3;;;;/h11H,4-10H2,1-3H3;;;;.
What are the key properties of alumane;2-methyldecane?
alumane;2-methyldecane has a molecular weight of 186.32 g/mol, XLogP of 3.21, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;2-methyldecane is sourced from PubChem (CID 174844655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).